CAS 88702-46-9
:2,5-Heptadien-4-one, 2-(4-bromophenyl)-6-methyl-, (E)-
Description:
2,5-Heptadien-4-one, 2-(4-bromophenyl)-6-methyl-, (E)- is an organic compound characterized by its conjugated diene structure, which includes a ketone functional group. The presence of the 4-bromophenyl group indicates that it has a bromine atom attached to a phenyl ring, contributing to its overall reactivity and potential applications in organic synthesis. The (E)- configuration denotes that the substituents around the double bond are on opposite sides, which can influence the compound's physical and chemical properties, such as boiling point and reactivity. This compound is likely to exhibit typical characteristics of unsaturated ketones, including susceptibility to nucleophilic attack and potential participation in various chemical reactions, such as addition or substitution. Its molecular structure suggests it may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling, as the presence of bromine can impart toxicity and environmental concerns.
Formula:C14H15BrO
InChI:InChI=1S/C14H15BrO/c1-10(2)8-14(16)9-11(3)12-4-6-13(15)7-5-12/h4-9H,1-3H3
InChI key:PPAIPMMNZWIPSC-UHFFFAOYSA-N
SMILES:CC(=CC(=O)C=C(C)C1=CC=C(C=C1)Br)C
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2,5-Heptadien-4-one, 2-(4-bromophenyl)-6-methyl-, (E)-
CAS:Formula:C14H15BrOMolecular weight:279.1723
