CymitQuimica logo

CAS 887029-70-1

:

2-[2-(butan-2-yl)phenoxy]propanoic acid

Description:
2-[2-(Butan-2-yl)phenoxy]propanoic acid, with the CAS number 887029-70-1, is a chemical compound that belongs to the class of phenoxypropanoic acids. This substance features a propanoic acid moiety attached to a phenoxy group, which is further substituted with a butan-2-yl group. The presence of the butan-2-yl group contributes to its hydrophobic characteristics, while the carboxylic acid functional group imparts acidic properties. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic and hydrophilic regions. Its structure suggests potential applications in agricultural chemistry, particularly as a herbicide or plant growth regulator, owing to the phenoxy group commonly associated with such activities. Additionally, the compound may exhibit specific biological activities, which would require further investigation to determine its efficacy and safety profile. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols to mitigate any risks associated with exposure.
Formula:C13H18O3
InChI:InChI=1/C13H18O3/c1-4-9(2)11-7-5-6-8-12(11)16-10(3)13(14)15/h5-10H,4H2,1-3H3,(H,14,15)
InChI key:RVCUDPXOVJSAHP-UHFFFAOYSA-N
SMILES:CCC(C)c1ccccc1OC(C)C(=O)O
Found 2 products.