CAS 88713-45-5
:Ethanol, 2-[(8-amino[1,2,4]triazolo[1,5-a]pyridin-2-yl)methoxy]-
Description:
Ethanol, 2-[(8-amino[1,2,4]triazolo[1,5-a]pyridin-2-yl)methoxy]- is a chemical compound characterized by its complex structure, which includes an ethanol moiety and a triazolopyridine derivative. The presence of the amino group suggests potential for hydrogen bonding and reactivity, while the triazole ring contributes to its heterocyclic nature, which can influence its biological activity and solubility. This compound is likely to exhibit polar characteristics due to the hydroxyl group in the ethanol part and the methoxy linkage, enhancing its solubility in polar solvents. The triazolo-pyridine structure may impart specific pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's molecular interactions could be significant in various applications, including drug development and synthesis. Its CAS number, 88713-45-5, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, this compound's unique structural features suggest a range of potential applications in both research and industry.
Formula:C9H12N4O2
InChI:InChI=1S/C9H12N4O2/c10-7-2-1-3-13-9(7)11-8(12-13)6-15-5-4-14/h1-3,14H,4-6,10H2
InChI key:DXOXMGXGVYTNTD-UHFFFAOYSA-N
SMILES:C1=CN2C(=NC(=N2)COCCO)C(=C1)N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ethanol, 2-[(8-amino[1,2,4]triazolo[1,5-a]pyridin-2-yl)methoxy]-
CAS:Formula:C9H12N4O2Molecular weight:208.2172
