CAS 88718-43-8
:Pyrylium, 2-[(4-chlorophenyl)methyl]-4,6-dimethyl-, perchlorate
Description:
Pyrylium, 2-[(4-chlorophenyl)methyl]-4,6-dimethyl-, perchlorate, identified by the CAS number 88718-43-8, is a chemical compound characterized by its pyrylium cation structure, which consists of a six-membered aromatic ring containing one oxygen atom and five carbon atoms. The presence of the 4-chlorobenzyl group and two methyl substituents at the 4 and 6 positions of the pyrylium ring contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The perchlorate anion indicates that this compound is a salt, which may influence its stability and solubility in various solvents. Pyrylium compounds are often studied for their applications in organic synthesis and materials science due to their electrophilic nature, making them useful intermediates in the formation of more complex organic molecules. Additionally, the presence of the chlorophenyl group may impart specific electronic and steric effects, affecting the compound's reactivity and interactions in chemical reactions.
Formula:C14H14ClOClO4
InChI:InChI=1S/C14H14ClO.ClHO4/c1-10-7-11(2)16-14(8-10)9-12-3-5-13(15)6-4-12;2-1(3,4)5/h3-8H,9H2,1-2H3;(H,2,3,4,5)/q+1;/p-1
InChI key:XXQDHEKBTGAETA-UHFFFAOYSA-M
SMILES:CC1=CC(=[O+]C(=C1)CC2=CC=C(C=C2)Cl)C.[O-]Cl(=O)(=O)=O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Pyrylium, 2-[(4-chlorophenyl)methyl]-4,6-dimethyl-, perchlorate
CAS:Formula:C14H14Cl2O5Molecular weight:333.164
