CymitQuimica logo

CAS 88723-97-1

:

Guanidine, [4-[2-(heptylamino)-1H-imidazol-4-yl]-2-thiazolyl]-

Description:
Guanidine, [4-[2-(heptylamino)-1H-imidazol-4-yl]-2-thiazolyl]- (CAS 88723-97-1) is a chemical compound characterized by its complex structure, which includes a guanidine moiety linked to a thiazole and imidazole ring system. This compound typically exhibits properties associated with both basicity and potential biological activity, owing to the presence of nitrogen-rich heterocycles. The heptylamino group contributes to its hydrophobic characteristics, which may influence its solubility and interaction with biological membranes. Such compounds are often investigated for their pharmacological properties, including antimicrobial and antiviral activities. Additionally, the presence of multiple functional groups suggests that it may participate in various chemical reactions, making it of interest in medicinal chemistry and drug design. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are critical for applications in both laboratory and therapeutic settings. Overall, this compound represents a unique intersection of organic chemistry and potential therapeutic applications.
Formula:C14H23N7S
InChI:InChI=1S/C14H23N7S/c1-2-3-4-5-6-7-17-13-18-8-10(19-13)11-9-22-14(20-11)21-12(15)16/h8-9H,2-7H2,1H3,(H2,17,18,19)(H4,15,16,20,21)
InChI key:AZLOYNCATTWTDU-UHFFFAOYSA-N
SMILES:CCCCCCCNC1=NC=C(N1)C2=CSC(=N2)N=C(N)N
Found 1 products.