CymitQuimica logo

CAS 88726-17-4

:

Lithium, 1H-cyclopent[e]azulen-1-yl-

Description:
Lithium, 1H-cyclopent[e]azulen-1-yl- (CAS 88726-17-4) is an organolithium compound characterized by the presence of a lithium atom bonded to a cyclopent[e]azulene structure. This compound features a fused ring system that includes both aromatic and non-aromatic characteristics, contributing to its unique chemical properties. Organolithium compounds are known for their strong nucleophilicity and reactivity, making them valuable in organic synthesis, particularly in the formation of carbon-carbon bonds. The presence of lithium enhances the compound's ability to act as a strong base and nucleophile, facilitating various chemical reactions. Additionally, the cyclopent[e]azulene moiety may impart specific electronic and steric properties, influencing its reactivity and interactions with other chemical species. Due to its specialized structure, this compound may find applications in materials science, organic synthesis, and potentially in the development of novel pharmaceuticals or catalysts. However, handling organolithium compounds requires caution due to their reactivity and potential hazards.
Formula:C13H9Li
InChI:InChI=1S/C13H9.Li/c1-4-10-6-2-8-12(10)13-9-3-7-11(13)5-1;/h1-9H;/q-1;+1
InChI key:OVFQBSSJSLHVMY-UHFFFAOYSA-N
SMILES:[Li+].[CH-]1C=CC2=C1C3=CC=CC3=CC=C2
Found 1 products.