CymitQuimica logo

CAS 887267-64-3

:

5-[4-(Trifluoromethoxy)phenyl]-4-oxazolecarboxylic acid

Description:
5-[4-(Trifluoromethoxy)phenyl]-4-oxazolecarboxylic acid is a chemical compound characterized by its unique structure, which includes an oxazole ring and a trifluoromethoxy group. The presence of the trifluoromethoxy substituent enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The oxazole ring contributes to its heterocyclic nature, which can affect its reactivity and interaction with biological targets. This compound is likely to exhibit acidic properties due to the carboxylic acid functional group, which can participate in hydrogen bonding and influence solubility in various solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with specific biological activities. Additionally, the trifluoromethoxy group may impart unique electronic properties, making it a candidate for further studies in drug design and synthesis. Overall, this compound represents a blend of structural features that could be leveraged for various chemical and biological applications.
Formula:C11H6F3NO4
InChI:InChI=1/C11H6F3NO4/c12-11(13,14)19-7-3-1-6(2-4-7)9-8(10(16)17)15-5-18-9/h1-5H,(H,16,17)
InChI key:InChIKey=GPSOZADUSXOMSV-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(OC=N1)C2=CC=C(OC(F)(F)F)C=C2
Synonyms:
  • 4-Oxazolecarboxylic Acid, 5-[4-(Trifluoromethoxy)Phenyl]-
  • 5-(4-Trifluoromethoxyphenyl)oxazole-4-carboxylic acid
  • 5-(4-Trifluoromethyoxyphenyl)-1,3-Oxazole-4-Carboxylic Acid
  • 5-[4-(Trifluoromethoxy)phenyl]-1,3-oxazole-4-carboxylic acid
  • 5-[4-(Trifluoromethoxy)phenyl]-4-oxazolecarboxylic acid
Found 2 products.