CymitQuimica logo

CAS 887344-26-5

:

3-(3-Pyridinyl)thiomorpholine

Description:
3-(3-Pyridinyl)thiomorpholine is a chemical compound characterized by its unique structure, which includes a thiomorpholine ring and a pyridine moiety. The thiomorpholine part contributes to its potential as a heterocyclic compound, often exhibiting interesting biological activities. The presence of the pyridine ring enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. This compound is typically a solid at room temperature and may have moderate stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both sulfur and nitrogen heteroatoms, which can participate in various chemical reactions. Additionally, the compound may exhibit properties such as antimicrobial or anti-inflammatory activities, making it a subject of interest in drug discovery. However, specific safety and handling guidelines should be followed, as with any chemical substance, to ensure safe laboratory practices.
Formula:C9H12N2S
InChI:InChI=1S/C9H12N2S/c1-2-8(6-10-3-1)9-7-12-5-4-11-9/h1-3,6,9,11H,4-5,7H2
InChI key:InChIKey=VMUCLRLJLVBTPL-UHFFFAOYSA-N
SMILES:C=1(C=CC=NC1)C2CSCCN2
Synonyms:
  • 3-(3-Pyridinyl)thiomorpholine
  • Thiomorpholine, 3-(3-pyridinyl)-
Found 2 products.