CymitQuimica logo

CAS 887344-27-6

:

Thiomorpholine,3-(4-methoxyphenyl)-

Description:
Thiomorpholine, 3-(4-methoxyphenyl)- is a chemical compound characterized by its unique structure, which includes a thiomorpholine ring and a para-methoxyphenyl substituent. The thiomorpholine moiety contributes to its potential as a heterocyclic compound, often exhibiting interesting biological activities. The presence of the methoxy group on the phenyl ring can influence the compound's solubility, reactivity, and interaction with biological targets. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which can affect pharmacological properties. Additionally, the compound's CAS number, 887344-27-6, allows for precise identification and retrieval of information in chemical databases. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would be essential for understanding its behavior in various environments and applications. Overall, thiomorpholine, 3-(4-methoxyphenyl)- represents a class of compounds that may have significant implications in research and industry.
Formula:C11H15NOS
InChI:InChI=1S/C11H15NOS/c1-13-10-4-2-9(3-5-10)11-8-14-7-6-12-11/h2-5,11-12H,6-8H2,1H3
InChI key:UZOTYVRGKFWQDG-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)C2CSCCN2
Found 3 products.