CymitQuimica logo

CAS 887344-35-6

:

3-(2-Pyrazinyl)benzaldehyde

Description:
3-(2-Pyrazinyl)benzaldehyde is an organic compound characterized by the presence of both a pyrazine and a benzaldehyde functional group. It features a pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms, fused to a benzaldehyde moiety, where the aldehyde group (-CHO) is attached to the benzene ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and dichloromethane. Its molecular structure allows for potential applications in various fields, including pharmaceuticals and agrochemicals, due to its ability to participate in diverse chemical reactions, such as condensation and substitution reactions. The presence of the pyrazine ring may also impart biological activity, making it of interest in medicinal chemistry. Additionally, 3-(2-Pyrazinyl)benzaldehyde can be synthesized through various methods, including the reaction of appropriate precursors under controlled conditions. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C11H8N2O
InChI:InChI=1S/C11H8N2O/c14-8-9-2-1-3-10(6-9)11-7-12-4-5-13-11/h1-8H
InChI key:InChIKey=CLHDOSZCXSKSSD-UHFFFAOYSA-N
SMILES:C(=O)C=1C=C(C=CC1)C=2C=NC=CN2
Synonyms:
  • 3-(2-Pyrazinyl)benzaldehyde
  • 3-(Pyrazin-2-yl)benzaldehyde
  • Benzaldehyde, 3-pyrazinyl-
  • Benzaldehyde,3-pyrazinyl- (9CI)
  • Benzaldehyde, 3-(2-pyrazinyl)-
Found 4 products.