CAS 88735-48-2

2H-1-Benzopyran-2-one, 3-(2-phenyl-4-thiazolyl)-

Description:

2H-1-Benzopyran-2-one, 3-(2-phenyl-4-thiazolyl)-, also known by its CAS number 88735-48-2, is a synthetic organic compound characterized by its complex structure that includes a benzopyran moiety and a thiazole ring. This compound typically exhibits properties associated with both flavonoids and thiazole derivatives, which may include antioxidant, anti-inflammatory, and potential anticancer activities. The presence of the thiazole group can enhance its biological activity and solubility in various solvents. In terms of physical properties, it may be a solid at room temperature, with a specific melting point and solubility profile that depend on the solvent used. The compound's reactivity can be influenced by the functional groups present, making it a candidate for further chemical modifications. Its applications may extend to pharmaceuticals, agrochemicals, or as a research tool in biochemical studies. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₈H₁₁NO₂S

InChI: InChI=1S/C18H11NO2S/c20-18-14(10-13-8-4-5-9-16(13)21-18)15-11-22-17(19-15)12-6-2-1-3-7-12/h1-11H

InChI key: NYIBHLXITYCPIF-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)C2=NC(=CS2)C3=CC4=CC=CC=C4OC3=O

2H-1-Benzopyran-2-one, 3-(2-phenyl-4-thiazolyl)-

CAS: 88735-48-2

Formula: C₁₈H₁₁NO₂S

Molecular weight: 305.3504

Ref: IN-DA0045I5