CymitQuimica logo

CAS 887353-29-9

:

tert-butyl (10-bromodecyl)carbamate

Description:
Tert-butyl (10-bromodecyl)carbamate is an organic compound characterized by its carbamate functional group, which is derived from the reaction of a carbamic acid with an alcohol. This compound features a tert-butyl group, providing steric hindrance and influencing its solubility and reactivity. The presence of a bromodecyl chain indicates that it has a long hydrophobic tail, which can enhance its lipophilicity and potential applications in various fields, including medicinal chemistry and materials science. The bromine atom in the structure can serve as a reactive site for further chemical modifications or substitutions. Tert-butyl (10-bromodecyl)carbamate may exhibit specific biological activities, making it of interest for research in drug development or as a biochemical probe. Its stability, solubility in organic solvents, and reactivity can be influenced by the surrounding environment, such as pH and temperature. Overall, this compound's unique structure and functional groups make it a versatile candidate for various chemical applications.
Formula:C15H30BrNO2
InChI:InChI=1/C15H30BrNO2/c1-15(2,3)19-14(18)17-13-11-9-7-5-4-6-8-10-12-16/h4-13H2,1-3H3,(H,17,18)
InChI key:OUQOWAUUYVRAFN-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=NCCCCCCCCCCBr)O
Found 6 products.