CymitQuimica logo

CAS 887360-48-7

:

5-(4-Ethoxyphenyl)-3-isoxazolecarboxylic acid

Description:
5-(4-Ethoxyphenyl)-3-isoxazolecarboxylic acid is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the ethoxyphenyl group enhances its lipophilicity, which may influence its solubility and biological activity. Typically, compounds like this can exhibit various pharmacological properties, making them of interest in medicinal chemistry. The isoxazole moiety is often associated with diverse biological activities, including anti-inflammatory and analgesic effects. Additionally, the compound's structure suggests potential for interactions with biological targets, which could be explored in drug development. Its CAS number, 887360-48-7, allows for precise identification in chemical databases and literature. Overall, 5-(4-Ethoxyphenyl)-3-isoxazolecarboxylic acid represents a unique structure that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C12H11NO4
InChI:InChI=1S/C12H11NO4/c1-2-16-9-5-3-8(4-6-9)11-7-10(12(14)15)13-17-11/h3-7H,2H2,1H3,(H,14,15)
InChI key:InChIKey=FTVWKNMSWDXJCY-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(ON1)C2=CC=C(OCC)C=C2
Synonyms:
  • 3-Isoxazolecarboxylic acid, 5-(4-ethoxyphenyl)-
  • 5-(4-Ethoxyphenyl)-3-isoxazolecarboxylic acid
Found 3 products.