CymitQuimica logo

CAS 88737-76-2

:

Benzo[f]quinazoline, 3-(4-methylphenyl)-

Description:
Benzo[f]quinazoline, 3-(4-methylphenyl)-, with the CAS number 88737-76-2, is an organic compound characterized by its fused ring structure, which includes a quinazoline moiety and a para-methylphenyl substituent. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for π-π stacking interactions. It is likely to be a solid at room temperature, with a relatively high melting point due to the rigidity of its structure. The presence of the methyl group on the phenyl ring can influence its solubility and reactivity, potentially enhancing lipophilicity. Benzo[f]quinazoline derivatives are of interest in medicinal chemistry due to their biological activity, including potential applications in cancer therapy and as kinase inhibitors. The compound's reactivity may also be influenced by the electron-donating nature of the methyl group, which can affect its interaction with various biological targets. Overall, this compound represents a class of heterocyclic compounds with significant implications in pharmaceutical research.
Formula:C19H14N2
InChI:InChI=1S/C19H14N2/c1-13-6-8-15(9-7-13)19-20-12-17-16-5-3-2-4-14(16)10-11-18(17)21-19/h2-12H,1H3
InChI key:QMCWRWSZYPSOTR-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)C2=NC=C3C(=N2)C=CC4=CC=CC=C43
Found 1 products.