CymitQuimica logo

CAS 887405-34-7

:

4-(1-Methylethyl)-1H-1,2,3-triazole-1-acetic acid

Description:
4-(1-Methylethyl)-1H-1,2,3-triazole-1-acetic acid, identified by its CAS number 887405-34-7, is a chemical compound that features a triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound is characterized by its unique functional groups, including a carboxylic acid (-COOH) and an isopropyl group, which contribute to its chemical reactivity and potential biological activity. The presence of the triazole moiety suggests that it may exhibit properties relevant to pharmaceuticals, such as antimicrobial or antifungal activities. Additionally, the compound's solubility and stability can be influenced by the pH of the environment, making it of interest in various chemical and biological applications. Its synthesis typically involves the reaction of appropriate precursors under controlled conditions, and it may be utilized in research settings to explore its interactions with biological systems or as a building block in the development of more complex molecules.
Formula:C7H11N3O2
InChI:InChI=1S/C7H11N3O2/c1-5(2)6-3-10(9-8-6)4-7(11)12/h3,5H,4H2,1-2H3,(H,11,12)
InChI key:InChIKey=WKPGRRKAOCAINH-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1C=C(C(C)C)N=N1
Synonyms:
  • (4-Isopropyl-[1,2,3]triazol-1-yl)-acetic acid
  • 1H-1,2,3-Triazole-1-acetic acid, 4-(1-methylethyl)-
  • 2-(4-Isopropyl-1H-[1,2,3]triazol-1-yl)acetic acid
  • 2-(4-Isopropyl-1H-1,2,3-triazol-1-yl)acetic acid
  • 4-(1-Methylethyl)-1H-1,2,3-triazole-1-acetic acid
Found 3 products.