CAS 88743-57-1
:Thiazolo[3,2-b][1,2,4]triazol-6(5H)-one, 5-methyl-2-phenyl-
Description:
Thiazolo[3,2-b][1,2,4]triazol-6(5H)-one, 5-methyl-2-phenyl- is a heterocyclic compound characterized by its unique fused ring structure, which incorporates both thiazole and triazole moieties. This compound typically exhibits properties associated with heterocycles, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the methyl and phenyl groups contributes to its lipophilicity and may influence its interaction with biological targets. The compound's structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, due to the reactivity of the nitrogen and sulfur atoms in the rings. Additionally, its stability and solubility can vary depending on the solvent and environmental conditions. As with many heterocycles, it may also exhibit fluorescence or other photophysical properties, which can be useful in applications such as imaging or sensing. Overall, this compound represents a class of substances that are valuable in research and potential therapeutic applications.
Formula:C11H9N3OS
InChI:InChI=1S/C11H9N3OS/c1-7-10(15)14-11(16-7)12-9(13-14)8-5-3-2-4-6-8/h2-7H,1H3
InChI key:ABADOUHEAZIJOC-UHFFFAOYSA-N
SMILES:CC1C(=O)N2C(=NC(=N2)C3=CC=CC=C3)S1
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Thiazolo[3,2-b][1,2,4]triazol-6(5H)-one, 5-methyl-2-phenyl-
CAS:Formula:C11H9N3OSMolecular weight:231.2737
