CAS 88744-00-7
:Carbonic acid, 4-chlorophenyl 9H-fluoren-9-ylmethyl ester
Description:
Carbonic acid, 4-chlorophenyl 9H-fluoren-9-ylmethyl ester, identified by the CAS number 88744-00-7, is an organic compound that features a carbonic acid moiety esterified with a 4-chlorophenyl group and a 9H-fluoren-9-ylmethyl group. This compound typically exhibits characteristics common to esters, such as being less polar than their corresponding acids, which can influence their solubility in organic solvents. The presence of the 4-chlorophenyl group may impart specific electronic and steric properties, potentially affecting reactivity and interactions with biological systems. The fluorenylmethyl group contributes to the compound's structural complexity and may enhance its stability and lipophilicity. As with many organic compounds, its behavior in chemical reactions can be influenced by factors such as pH, temperature, and the presence of catalysts. Understanding its properties is essential for applications in fields like medicinal chemistry, where such compounds may serve as intermediates or active pharmaceutical ingredients. Safety data should be consulted for handling and usage guidelines, as with any chemical substance.
Formula:C21H15ClO3
InChI:InChI=1S/C21H15ClO3/c22-14-9-11-15(12-10-14)25-21(23)24-13-20-18-7-3-1-5-16(18)17-6-2-4-8-19(17)20/h1-12,20H,13H2
InChI key:NSEARCXYGTXBOR-UHFFFAOYSA-N
SMILES:C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)OC4=CC=C(C=C4)Cl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Carbonic acid, 4-chlorophenyl 9H-fluoren-9-ylmethyl ester
CAS:Formula:C21H15ClO3Molecular weight:350.795
