CAS 88744-13-2
:Propanedioic acid, [benzoyl(3-methylphenyl)amino]-, diethyl ester
Description:
Propanedioic acid, [benzoyl(3-methylphenyl)amino]-, diethyl ester, commonly referred to as a diethyl ester derivative of a substituted propanedioic acid, is characterized by its complex structure that includes both an ester and an amine functional group. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid with a pleasant odor. It is likely to be soluble in organic solvents while having limited solubility in water due to its hydrophobic aromatic components. The presence of the benzoyl and 3-methylphenyl groups suggests potential for aromatic interactions, which may influence its reactivity and stability. Additionally, the compound may participate in various chemical reactions typical of esters, such as hydrolysis and transesterification. Its applications could span across fields like pharmaceuticals, agrochemicals, or as intermediates in organic synthesis, although specific uses would depend on further research and development. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C21H23NO5
InChI:InChI=1S/C21H23NO5/c1-4-26-20(24)18(21(25)27-5-2)22(17-13-9-10-15(3)14-17)19(23)16-11-7-6-8-12-16/h6-14,18H,4-5H2,1-3H3
InChI key:YNVNUCDVHUGQSG-UHFFFAOYSA-N
SMILES:CCOC(=O)C(C(=O)OCC)N(C1=CC=CC(=C1)C)C(=O)C2=CC=CC=C2
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Propanedioic acid, [benzoyl(3-methylphenyl)amino]-, diethyl ester
CAS:Formula:C21H23NO5Molecular weight:369.411
