CymitQuimica logo

CAS 88745-07-7

:

3H-Pyrrole-3,3,4-tricarbonitrile, 5-amino-2-ethyl-1,2-dihydro-1-pentyl-

Description:
3H-Pyrrole-3,3,4-tricarbonitrile, 5-amino-2-ethyl-1,2-dihydro-1-pentyl- is a complex organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing nitrogen. The presence of multiple cyano (nitrile) groups contributes to its reactivity and potential applications in various fields, including materials science and pharmaceuticals. The amino group in the structure suggests potential for further chemical modifications, enhancing its utility in synthesis. The compound's dihydro configuration indicates it may exhibit unique properties compared to fully aromatic compounds, such as altered solubility and reactivity. Additionally, the presence of alkyl chains, like the pentyl and ethyl groups, can influence its physical properties, such as boiling point and melting point, as well as its interaction with biological systems. Overall, this compound's unique structural features make it a subject of interest for research in organic chemistry and related applications.
Formula:C14H19N5
InChI:InChI=1S/C14H19N5/c1-3-5-6-7-19-12(4-2)14(9-16,10-17)11(8-15)13(19)18/h12H,3-7,18H2,1-2H3
InChI key:MTYDSYLQOSOJIT-UHFFFAOYSA-N
SMILES:CCCCCN1C(C(C(=C1N)C#N)(C#N)C#N)CC
Found 1 products.