CymitQuimica logo

CAS 88745-11-3

:

1H-Pyrrole-3,4-dicarbonitrile, 2-amino-1-(4-hydroxyphenyl)-5-phenyl-

Description:
1H-Pyrrole-3,4-dicarbonitrile, 2-amino-1-(4-hydroxyphenyl)-5-phenyl- is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features multiple functional groups, including dicarbonitrile groups, which are characterized by the presence of two cyano (-C≡N) groups, and an amino (-NH2) group, contributing to its reactivity and potential applications in organic synthesis. The presence of a hydroxyphenyl group indicates that it has a phenolic component, which can influence its solubility and reactivity. The compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis due to its diverse functional groups. Additionally, the presence of multiple aromatic rings may impart interesting electronic properties, making it a candidate for studies in materials science or medicinal chemistry. As with many organic compounds, its physical properties, such as solubility, melting point, and stability, would depend on the specific conditions and environment in which it is studied.
Formula:C18H12N4O
InChI:InChI=1S/C18H12N4O/c19-10-15-16(11-20)18(21)22(13-6-8-14(23)9-7-13)17(15)12-4-2-1-3-5-12/h1-9,23H,21H2
InChI key:XENGZDVMRPOAPR-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=C(C(=C(N2C3=CC=C(C=C3)O)N)C#N)C#N
Found 1 products.