CAS 88745-67-9
:Propanoic acid, 3-(5-methoxy-2(5H)-furanylidene)-, methyl ester, (E)-
Description:
Propanoic acid, 3-(5-methoxy-2(5H)-furanylidene)-, methyl ester, (E)- is an organic compound characterized by its ester functional group and a furan ring structure. This compound features a propanoic acid moiety, which contributes to its acidity and potential reactivity. The presence of the methoxy group enhances its solubility in organic solvents and may influence its biological activity. The (E)- configuration indicates that the substituents around the double bond are on opposite sides, which can affect the compound's physical properties and reactivity. Generally, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the furan ring can participate in various chemical reactions, including electrophilic substitutions and polymerizations. The compound's molecular structure suggests potential applications in fields such as agrochemicals, pharmaceuticals, or as intermediates in organic synthesis. However, specific properties such as boiling point, melting point, and solubility would require empirical data for precise characterization.
Formula:C9H12O4
InChI:InChI=1S/C9H12O4/c1-11-8(10)5-3-7-4-6-9(12-2)13-7/h3-4,6,9H,5H2,1-2H3/b7-3+
InChI key:RADTZRJDIVKRSS-XVNBXDOJSA-N
SMILES:COC1C=C/C(=C\CC(=O)OC)/O1
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Propanoic acid, 3-(5-methoxy-2(5H)-furanylidene)-, methyl ester, (E)-
CAS:Formula:C9H12O4Molecular weight:184.1892
