CAS 88745-91-9
:Butanoic acid, 2-bromo-2-methyl-, 1,1-dimethylethyl ester
Description:
Butanoic acid, 2-bromo-2-methyl-, 1,1-dimethylethyl ester, with the CAS number 88745-91-9, is an organic compound characterized by its ester functional group, which is formed from the reaction of butanoic acid and an alcohol. This compound features a branched structure due to the presence of a 2-bromo-2-methyl group, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a characteristic odor. The presence of the bromine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The ester group generally imparts a degree of hydrophobicity, affecting its solubility in water and organic solvents. Additionally, this compound may exhibit moderate volatility and can be sensitive to heat and light. Its applications may span across fields such as organic synthesis, pharmaceuticals, and agrochemicals, although specific uses would depend on further research and development. Safety precautions should be observed when handling this compound due to potential toxicity and environmental impact.
Formula:C9H17BrO2
InChI:InChI=1S/C9H17BrO2/c1-6-9(5,10)7(11)12-8(2,3)4/h6H2,1-5H3
InChI key:GNUAVBFJGRWSDE-UHFFFAOYSA-N
SMILES:CCC(C)(C(=O)OC(C)(C)C)Br
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Butanoic acid, 2-bromo-2-methyl-, 1,1-dimethylethyl ester
CAS:Formula:C9H17BrO2Molecular weight:237.1341
