CAS 88746-48-9
:11H-Benzo[b]fluorene-11-carboxylic acid
Description:
11H-Benzo[b]fluorene-11-carboxylic acid is an organic compound characterized by its fused polycyclic aromatic structure, which includes a benzo[b]fluorene core with a carboxylic acid functional group at the 11-position. This compound typically exhibits properties associated with aromatic compounds, such as stability and hydrophobicity, due to its extensive π-electron system. The presence of the carboxylic acid group introduces polar characteristics, allowing for potential hydrogen bonding and increased solubility in polar solvents compared to its non-acidic counterparts. It may also participate in various chemical reactions, including esterification and acid-base reactions, due to the reactivity of the carboxylic acid group. Additionally, compounds like 11H-Benzo[b]fluorene-11-carboxylic acid are of interest in materials science and organic synthesis, potentially serving as intermediates in the production of dyes, pharmaceuticals, or other functional materials. Its unique structure and functional group make it a subject of study in both organic chemistry and materials science.
Formula:C18H12O2
InChI:InChI=1S/C18H12O2/c19-18(20)17-14-8-4-3-7-13(14)15-9-11-5-1-2-6-12(11)10-16(15)17/h1-10,17H,(H,19,20)
InChI key:LDBNZCXGWUGYQP-UHFFFAOYSA-N
SMILES:C1=CC=C2C=C3C4=CC=CC=C4C(C3=CC2=C1)C(=O)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
