CymitQuimica logo

CAS 887475-64-1

:

1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-3-carbaldehyde

Description:
1-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-3-carbaldehyde is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a dioxaborolane moiety. The presence of the aldehyde functional group contributes to its reactivity, making it useful in various synthetic applications. The compound is likely to exhibit moderate solubility in organic solvents due to its polar functional groups, while the bulky dioxaborolane substituent may influence its steric properties and reactivity. This compound may be of interest in medicinal chemistry and materials science, particularly in the development of boron-containing compounds for applications such as drug design or as intermediates in organic synthesis. Additionally, the presence of the methyl group on the pyrazole ring can affect its electronic properties and stability. Overall, this compound represents a versatile building block in organic synthesis, with potential applications in various fields of chemistry.
Formula:C11H17BN2O3
InChI:InChI=1/C11H17BN2O3/c1-10(2)11(3,4)17-12(16-10)8-6-14(5)13-9(8)7-15/h6-7H,1-5H3
InChI key:SOSDLPVXZCCRHR-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2cn(C)nc2C=O)O1
Found 5 products.