CAS 88753-47-3
:Pyridine, 3,3'-azoxybis[2,6-bis(ethylthio)-
Description:
Pyridine, 3,3'-azoxybis[2,6-bis(ethylthio)-] is an organic compound characterized by its azoxy functional group and pyridine rings. The presence of the ethylthio substituents enhances its solubility in organic solvents and may influence its reactivity and interaction with other chemical species. This compound typically exhibits a yellow to brown color and may have a distinct odor associated with pyridine derivatives. It is likely to be stable under standard conditions but may undergo decomposition or reaction under extreme temperatures or in the presence of strong oxidizing agents. The azoxy linkage suggests potential applications in organic synthesis and materials science, particularly in the development of dyes or pigments. Additionally, the compound's structure may impart specific electronic properties, making it of interest in various chemical and pharmaceutical applications. Safety data should be consulted for handling and storage, as compounds with sulfur and nitrogen functionalities can pose health risks.
Formula:C18H24N4OS4
InChI:InChI=1S/C18H24N4OS4/c1-5-24-15-11-9-13(17(19-15)26-7-3)21-22(23)14-10-12-16(25-6-2)20-18(14)27-8-4/h9-12H,5-8H2,1-4H3
InChI key:SSMULOHVOQWRNH-UHFFFAOYSA-N
SMILES:CCSC1=NC(=C(C=C1)N=[N+](C2=C(N=C(C=C2)SCC)SCC)[O-])SCC
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
