CymitQuimica logo

CAS 88753-70-2

:

4H-1-Benzopyran-4-one, 2-(diethylamino)-3,6-dinitro-

Description:
4H-1-Benzopyran-4-one, 2-(diethylamino)-3,6-dinitro- is an organic compound characterized by its complex structure, which includes a benzopyran moiety and two nitro groups at the 3 and 6 positions. The presence of the diethylamino group at the 2 position contributes to its potential as a dye or pharmaceutical intermediate. This compound typically exhibits a yellow to orange color due to the conjugated system within its structure, which can also influence its light absorption properties. It is likely to be soluble in organic solvents, while its solubility in water may be limited due to the hydrophobic nature of the benzopyran ring. The nitro groups can impart significant reactivity, making this compound of interest in various chemical reactions, including nitration and reduction processes. Additionally, the presence of the diethylamino group may enhance its basicity and influence its interaction with biological systems, suggesting potential applications in medicinal chemistry or as a synthetic intermediate. Safety precautions should be observed due to the presence of nitro groups, which can be hazardous.
Formula:C13H13N3O6
InChI:InChI=1S/C13H13N3O6/c1-3-14(4-2)13-11(16(20)21)12(17)9-7-8(15(18)19)5-6-10(9)22-13/h5-7H,3-4H2,1-2H3
InChI key:NGBNCODCCUIZFF-UHFFFAOYSA-N
SMILES:CCN(CC)C1=C(C(=O)C2=C(O1)C=CC(=C2)[N+](=O)[O-])[N+](=O)[O-]
Synonyms:
  • 2-(dietilammino)-3,6-dinitrocromone
  • 4H-1-Benzopyran-4-one, 2-(diethylamino)-3,6-dinitro-
Found 1 products.