CAS 88754-63-6
:1,4,2,3-Dioxadiazine, 2,3-diethyltetrahydro-
Description:
1,4,2,3-Dioxadiazine, 2,3-diethyltetrahydro- is a heterocyclic organic compound characterized by its unique ring structure that includes both nitrogen and oxygen atoms. This compound features a dioxadiazine framework, which consists of a six-membered ring containing two nitrogen atoms and two oxygen atoms, contributing to its potential reactivity and stability. The presence of ethyl groups at the 2 and 3 positions of the tetrahydro structure enhances its hydrophobic characteristics and may influence its solubility in organic solvents. Typically, compounds of this nature are studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis due to their unique electronic properties and ability to participate in various chemical reactions. The specific properties, such as boiling point, melting point, and reactivity, would depend on the molecular interactions and substituents present. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management.
Formula:C6H14N2O2
InChI:InChI=1S/C6H14N2O2/c1-3-7-8(4-2)10-6-5-9-7/h3-6H2,1-2H3
InChI key:XFRVWSIDCBQGDG-UHFFFAOYSA-N
SMILES:CCN1N(OCCO1)CC
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
