CymitQuimica logo

CAS 88756-05-2

:

N,N-diethyl-N'-(6-methoxy-4-methylquinolin-8-yl)ethane-1,2-diamine

Description:
N,N-Diethyl-N'-(6-methoxy-4-methylquinolin-8-yl)ethane-1,2-diamine is a chemical compound characterized by its complex structure, which includes a quinoline moiety and two ethyl groups attached to an ethane-1,2-diamine backbone. This compound typically exhibits properties associated with both amines and quinoline derivatives, such as potential basicity due to the presence of nitrogen atoms. The methoxy and methyl substituents on the quinoline ring can influence its solubility, reactivity, and biological activity. It may display fluorescence properties, making it useful in various applications, including as a fluorescent probe in biochemical assays. Additionally, the presence of multiple functional groups suggests that it could participate in various chemical reactions, including nucleophilic substitutions and complexation with metal ions. Its specific applications may vary, but compounds of this nature are often explored in medicinal chemistry for their potential therapeutic effects. Safety and handling precautions should be observed, as with any chemical substance, due to the potential for toxicity or reactivity.
Formula:C17H25N3O
InChI:InChI=1/C17H25N3O/c1-5-20(6-2)10-9-18-16-12-14(21-4)11-15-13(3)7-8-19-17(15)16/h7-8,11-12,18H,5-6,9-10H2,1-4H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.