CymitQuimica logo

CAS 88757-28-2

:

Acetonitrile, [(5-methyl-8-quinolinyl)oxy]-

Description:
Acetonitrile, [(5-methyl-8-quinolinyl)oxy]- is a chemical compound characterized by its unique structure, which includes a quinoline moiety linked to an acetonitrile group. This compound is typically a colorless liquid with a moderate boiling point and is known for its polar aprotic nature, making it a useful solvent in various chemical reactions, particularly in organic synthesis and chromatography. The presence of the quinoline ring imparts specific biological and chemical properties, potentially allowing for interactions with biological targets. It is important to handle this substance with care, as it may pose health risks upon exposure, including irritation to the skin and respiratory system. Additionally, acetonitrile derivatives can exhibit varying degrees of toxicity, necessitating appropriate safety measures during use. Overall, the compound's unique structural features and properties make it valuable in both industrial applications and research settings.
Formula:C12H10N2O
InChI:InChI=1S/C12H10N2O/c1-9-4-5-11(15-8-6-13)12-10(9)3-2-7-14-12/h2-5,7H,8H2,1H3
InChI key:FPQYNMIPHSIVOX-UHFFFAOYSA-N
SMILES:CC1=C2C=CC=NC2=C(C=C1)OCC#N
Found 1 products.