CAS 88757-45-3
:Propanenitrile, 2-[(5-chloro-2-methyl-8-quinolinyl)oxy]-
Description:
Propanenitrile, 2-[(5-chloro-2-methyl-8-quinolinyl)oxy]- is a chemical compound characterized by its unique structure, which includes a propanenitrile group and a quinoline derivative. The presence of the chloro and methyl substituents on the quinoline ring contributes to its potential biological activity and chemical reactivity. This compound is likely to exhibit properties typical of nitriles, such as being polar and capable of participating in nucleophilic reactions. The quinoline moiety may impart additional characteristics, including potential fluorescence and the ability to interact with biological targets, making it of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards. Overall, the combination of functional groups in this compound suggests a diverse range of applications, particularly in pharmaceuticals and agrochemicals.
Formula:C13H11ClN2O
InChI:InChI=1S/C13H11ClN2O/c1-8-3-4-10-11(14)5-6-12(13(10)16-8)17-9(2)7-15/h3-6,9H,1-2H3
InChI key:YESGILNHLRDVLM-UHFFFAOYSA-N
SMILES:CC1=NC2=C(C=CC(=C2C=C1)Cl)OC(C)C#N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Propanenitrile, 2-[(5-chloro-2-methyl-8-quinolinyl)oxy]-
CAS:Formula:C13H11ClN2OMolecular weight:246.6922
