CymitQuimica logo

CAS 88757-46-4

:

Acetonitrile, [(5-bromo-2-methyl-8-quinolinyl)oxy]-

Description:
Acetonitrile, [(5-bromo-2-methyl-8-quinolinyl)oxy]- is a chemical compound characterized by its unique structure, which includes a quinoline moiety substituted with a bromine atom and a methyl group, linked to an acetonitrile functional group. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. It exhibits properties common to nitriles, such as being a polar aprotic solvent, which makes it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the quinoline structure may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the bromine substitution can enhance the compound's reactivity and solubility in organic solvents. Safety considerations include handling it in a well-ventilated area and using appropriate personal protective equipment, as nitriles can be toxic and irritant. Overall, this compound's unique characteristics make it valuable in both research and industrial applications.
Formula:C12H9BrN2O
InChI:InChI=1S/C12H9BrN2O/c1-8-2-3-9-10(13)4-5-11(12(9)15-8)16-7-6-14/h2-5H,7H2,1H3
InChI key:YNSQVSGFOZWXJG-UHFFFAOYSA-N
SMILES:CC1=NC2=C(C=CC(=C2C=C1)Br)OCC#N
Found 1 products.