CymitQuimica logo

CAS 88757-53-3

:

Propanenitrile, 2-[(7-bromo-5-chloro-8-quinolinyl)oxy]-

Description:
Propanenitrile, 2-[(7-bromo-5-chloro-8-quinolinyl)oxy]- is a chemical compound characterized by its unique structure, which includes a propanenitrile group and a quinoline derivative. The presence of the bromine and chlorine substituents on the quinoline ring contributes to its potential biological activity and reactivity. This compound is likely to exhibit properties typical of nitriles, such as being polar and capable of participating in nucleophilic reactions. The quinoline moiety may impart additional characteristics, including potential fluorescence and the ability to interact with biological targets, making it of interest in medicinal chemistry. The compound's solubility, stability, and reactivity can vary depending on the solvent and environmental conditions. As with many halogenated compounds, it may also exhibit specific toxicological properties that necessitate careful handling. Overall, propanenitrile, 2-[(7-bromo-5-chloro-8-quinolinyl)oxy]- represents a complex structure with potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and uses.
Formula:C12H8BrClN2O
InChI:InChI=1S/C12H8BrClN2O/c1-7(6-15)17-12-9(13)5-10(14)8-3-2-4-16-11(8)12/h2-5,7H,1H3
InChI key:PMBHZQASABXQPV-UHFFFAOYSA-N
SMILES:CC(C#N)OC1=C(C=C(C2=C1N=CC=C2)Cl)Br
Found 1 products.