CAS 88757-76-0
:Propanimidamide, 2-[(7-bromo-5-chloro-8-quinolinyl)oxy]-N-hydroxy-
Description:
Propanimidamide, 2-[(7-bromo-5-chloro-8-quinolinyl)oxy]-N-hydroxy- is a chemical compound characterized by its unique structural features, including a quinoline moiety and a hydroxylamine functional group. The presence of bromine and chlorine substituents on the quinoline ring contributes to its potential biological activity, possibly enhancing its interaction with various biological targets. This compound may exhibit properties such as antimicrobial or anticancer activity, which are common in quinoline derivatives. The N-hydroxy group can also play a role in reactivity, potentially participating in various chemical reactions or influencing the compound's solubility and stability. As with many synthetic organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the environment in which it is studied. Safety and handling precautions are essential when working with this compound, as halogenated compounds can pose health risks. Further research is necessary to fully elucidate its pharmacological profile and potential applications in medicinal chemistry.
Formula:C12H11BrClN3O2
InChI:InChI=1S/C12H11BrClN3O2/c1-6(12(15)17-18)19-11-8(13)5-9(14)7-3-2-4-16-10(7)11/h2-6,18H,1H3,(H2,15,17)
InChI key:FDOXKXQZRZCJII-UHFFFAOYSA-N
SMILES:CC(C(=NO)N)OC1=C(C=C(C2=C1N=CC=C2)Cl)Br
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Propanimidamide, 2-[(7-bromo-5-chloro-8-quinolinyl)oxy]-N-hydroxy-
CAS:Formula:C12H11BrClN3O2Molecular weight:344.5916
