CymitQuimica logo

CAS 88757-86-2

:

Acetonitrile, [(7-iodo-2-methyl-5-nitro-8-quinolinyl)oxy]-

Description:
Acetonitrile, specifically the compound with the name "[(7-iodo-2-methyl-5-nitro-8-quinolinyl)oxy]-" and CAS number 88757-86-2, is a chemical substance that features a quinoline derivative. This compound is characterized by the presence of a quinoline ring system, which is a bicyclic structure known for its aromatic properties and biological activity. The presence of iodine, methyl, and nitro substituents on the quinoline ring contributes to its unique chemical reactivity and potential applications in pharmaceuticals or agrochemicals. Acetonitrile itself is a polar aprotic solvent commonly used in organic synthesis and chromatography. The specific functional groups in this compound may impart distinct properties such as solubility, reactivity, and biological activity. Additionally, the compound's structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those derived from heterocyclic systems.
Formula:C12H8IN3O3
InChI:InChI=1S/C12H8IN3O3/c1-7-2-3-8-10(16(17)18)6-9(13)12(11(8)15-7)19-5-4-14/h2-3,6H,5H2,1H3
InChI key:FPWGEISSNGOKRL-UHFFFAOYSA-N
SMILES:CC1=NC2=C(C=C1)C(=CC(=C2OCC#N)I)[N+](=O)[O-]
Found 1 products.