CymitQuimica logo

CAS 88757-87-3

:

Ethanimidamide, 2-[(5-chloro-8-quinolinyl)oxy]-N-(1-oxobutoxy)-

Description:
Ethanimidamide, 2-[(5-chloro-8-quinolinyl)oxy]-N-(1-oxobutoxy)-, identified by its CAS number 88757-87-3, is a chemical compound that features a quinoline moiety, which is known for its biological activity and potential pharmacological applications. This compound contains an ethanimidamide functional group, which is characterized by the presence of an amide bond, contributing to its reactivity and interaction with biological systems. The chloro substituent on the quinoline ring enhances its lipophilicity, potentially influencing its ability to penetrate biological membranes. The presence of the butoxy group suggests that the compound may exhibit solubility in organic solvents, which is often advantageous for drug formulation. Overall, this compound's structural features indicate potential utility in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways. However, detailed studies on its pharmacodynamics, toxicity, and efficacy would be necessary to fully understand its potential applications.
Formula:C15H16ClN3O3
InChI:InChI=1S/C15H16ClN3O3/c1-2-4-14(20)22-19-13(17)9-21-12-7-6-11(16)10-5-3-8-18-15(10)12/h3,5-8H,2,4,9H2,1H3,(H2,17,19)
InChI key:ARFALSRFGYNQKF-UHFFFAOYSA-N
SMILES:CCCC(=O)ON=C(COC1=C2C(=C(C=C1)Cl)C=CC=N2)N
Found 1 products.