CAS 887579-65-9
:Benzenamine,3-(4-propylphenoxy)-
Description:
Benzenamine, 3-(4-propylphenoxy)-, also known by its CAS number 887579-65-9, is an organic compound characterized by the presence of an aniline group (benzenamine) substituted with a propylphenoxy moiety. This compound features a benzene ring with an amino group (-NH2) at the 3-position and a propylphenoxy group at the para position. The presence of the propyl group enhances its hydrophobic characteristics, potentially influencing its solubility and reactivity in various solvents. The compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its interactions in biological systems or chemical reactions. Additionally, the presence of the ether linkage (phenoxy) suggests potential applications in organic synthesis or as an intermediate in the production of more complex molecules. Overall, the structural features of Benzenamine, 3-(4-propylphenoxy)- suggest it may have utility in various chemical and pharmaceutical applications, although specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C15H17NO
InChI:InChI=1S/C15H17NO/c1-2-4-12-7-9-14(10-8-12)17-15-6-3-5-13(16)11-15/h3,5-11H,2,4,16H2,1H3
InChI key:MUGUJRSYUSHCBS-UHFFFAOYSA-N
SMILES:CCCC1=CC=C(C=C1)OC2=CC=CC(=C2)N
Synonyms:- 3-(4-PROPYL-PHENOXY)-PHENYLAMINE
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
