CAS 887579-72-8
:Benzenamine,3-[4-(1-methylethyl)phenoxy]-
Description:
Benzenamine, 3-[4-(1-methylethyl)phenoxy]- is an organic compound characterized by its aromatic amine structure, which includes a benzene ring substituted with an amine group and a phenoxy group. The presence of the isopropyl group (1-methylethyl) on the para position of the phenoxy moiety contributes to its hydrophobic characteristics, influencing its solubility and reactivity. This compound is likely to exhibit moderate to low solubility in water due to its hydrophobic nature, while being more soluble in organic solvents. The amine functional group can participate in hydrogen bonding, which may affect its boiling and melting points. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its CAS number, 887579-72-8, allows for precise identification in chemical databases, facilitating further studies on its properties, synthesis, and potential applications. Overall, the unique structural features of Benzenamine, 3-[4-(1-methylethyl)phenoxy]- suggest a range of chemical behaviors and potential uses in various fields.
Formula:C15H17NO
InChI:InChI=1S/C15H17NO/c1-11(2)12-6-8-14(9-7-12)17-15-5-3-4-13(16)10-15/h3-11H,16H2,1-2H3
InChI key:RLEVVSQFSPHWBN-UHFFFAOYSA-N
SMILES:CC(C)C1=CC=C(C=C1)OC2=CC=CC(=C2)N
Synonyms:- 3-(4-ISOPROPYL-PHENOXY)-PHENYLAMINE
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
