CAS 88758-06-9
:Ethanimidamide, N-[(3,4-dichlorobenzoyl)oxy]-2-(8-quinolinyloxy)-
Description:
Ethanimidamide, N-[(3,4-dichlorobenzoyl)oxy]-2-(8-quinolinyloxy)-, with the CAS number 88758-06-9, is a chemical compound characterized by its complex structure, which includes an ethanimidamide backbone, a 3,4-dichlorobenzoyloxy group, and an 8-quinolinyloxy moiety. This compound is typically classified as an organic molecule and may exhibit properties such as solubility in organic solvents, depending on its specific functional groups. The presence of the dichlorobenzoyl group suggests potential biological activity, as halogenated aromatic compounds often interact with biological systems. The quinoline structure is known for its pharmacological significance, including antimicrobial and antitumor activities. The compound's reactivity and stability can be influenced by the functional groups attached to the core structure, which may also affect its potential applications in medicinal chemistry or as a research tool. Overall, this compound represents a unique combination of structural features that may contribute to its chemical behavior and biological interactions.
Formula:C18H13Cl2N3O3
InChI:InChI=1S/C18H13Cl2N3O3/c19-13-7-6-12(9-14(13)20)18(24)26-23-16(21)10-25-15-5-1-3-11-4-2-8-22-17(11)15/h1-9H,10H2,(H2,21,23)
InChI key:BYYHEYYECFWVLW-UHFFFAOYSA-N
SMILES:C1=CC2=C(C(=C1)OCC(=NOC(=O)C3=CC(=C(C=C3)Cl)Cl)N)N=CC=C2
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ethanimidamide, N-[(3,4-dichlorobenzoyl)oxy]-2-(8-quinolinyloxy)-
CAS:Formula:C18H13Cl2N3O3Molecular weight:390.2201
