CAS 88758-33-2
:Ethanimidamide, N-[[(2-chloroethoxy)carbonyl]oxy]-2-(8-quinolinyloxy)-
Description:
Ethanimidamide, N-[[(2-chloroethoxy)carbonyl]oxy]-2-(8-quinolinyloxy)-, identified by CAS number 88758-33-2, is a chemical compound characterized by its complex structure that includes an ethanimidamide moiety linked to a chloroethoxycarbonyl group and a quinolinyloxy group. This compound typically exhibits properties associated with both amides and esters, which may influence its solubility, reactivity, and potential biological activity. The presence of the chloroethoxy group suggests potential for nucleophilic substitution reactions, while the quinolinyloxy component may impart specific interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure indicates it may participate in hydrogen bonding due to the amide functional group, which can affect its physical properties such as melting point and boiling point. Additionally, the presence of halogen atoms can enhance its reactivity and influence its pharmacokinetic properties. Overall, this compound's unique characteristics make it a subject of interest for further research, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C14H14ClN3O4
InChI:InChI=1S/C14H14ClN3O4/c15-6-8-20-14(19)22-18-12(16)9-21-11-5-1-3-10-4-2-7-17-13(10)11/h1-5,7H,6,8-9H2,(H2,16,18)
InChI key:CMWHSYOLJRWYFN-UHFFFAOYSA-N
SMILES:C1=CC2=C(C(=C1)OCC(=NOC(=O)OCCCl)N)N=CC=C2
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ethanimidamide, N-[[(2-chloroethoxy)carbonyl]oxy]-2-(8-quinolinyloxy)-
CAS:Formula:C14H14ClN3O4Molecular weight:323.7317
