CAS 88758-35-4
:Ethanimidamide, 2-[(5-chloro-8-quinolinyl)oxy]-N-[(1-oxo-2-butenyl)oxy]-
Description:
Ethanimidamide, 2-[(5-chloro-8-quinolinyl)oxy]-N-[(1-oxo-2-butenyl)oxy]- is a chemical compound characterized by its complex structure, which includes a quinoline moiety and an ethanimidamide functional group. The presence of a chloro substituent on the quinoline ring enhances its biological activity, potentially influencing its interaction with various biological targets. The compound features an ether linkage due to the oxy groups, which may contribute to its solubility and reactivity. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with quinoline derivatives are often explored for their antimicrobial and anticancer properties. The specific arrangement of functional groups in this compound may also affect its pharmacokinetics and pharmacodynamics, making it a subject of interest for further research. As with many chemical substances, safety and handling precautions should be observed, given the potential toxicity associated with certain halogenated compounds.
Formula:C15H14ClN3O3
InChI:InChI=1S/C15H14ClN3O3/c1-2-4-14(20)22-19-13(17)9-21-12-7-6-11(16)10-5-3-8-18-15(10)12/h2-8H,9H2,1H3,(H2,17,19)/b4-2+
InChI key:MBGMVAJZVSGONE-DUXPYHPUSA-N
SMILES:C/C=C/C(=O)O/N=C(/COC1=C2C(=C(C=C1)Cl)C=CC=N2)\N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ethanimidamide, 2-[(5-chloro-8-quinolinyl)oxy]-N-[(1-oxo-2-butenyl)oxy]-
CAS:Formula:C15H14ClN3O3Molecular weight:319.743
