CymitQuimica logo

CAS 88758-38-7

:

Ethanimidamide, N-(2-ethyl-1-oxobutoxy)-2-(8-quinolinyloxy)-

Description:
Ethanimidamide, N-(2-ethyl-1-oxobutoxy)-2-(8-quinolinyloxy)-, with the CAS number 88758-38-7, is a chemical compound that features a complex structure incorporating an ethanimidamide moiety along with an ether linkage and a quinoline derivative. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the quinoline ring suggests possible interactions with biological targets, making it of interest in drug development. The ethyl and oxobutoxy groups contribute to its lipophilicity, which can influence its absorption and distribution in biological systems. Additionally, the compound may exhibit specific reactivity patterns due to the functional groups present, which can be leveraged in synthetic applications or as a precursor in further chemical modifications. Overall, the unique structural features of this compound position it as a candidate for various applications in research and development within the fields of pharmaceuticals and organic chemistry.
Formula:C17H21N3O3
InChI:InChI=1S/C17H21N3O3/c1-3-12(4-2)17(21)23-20-15(18)11-22-14-9-5-7-13-8-6-10-19-16(13)14/h5-10,12H,3-4,11H2,1-2H3,(H2,18,20)
InChI key:ANUSHAPHRLDSFF-UHFFFAOYSA-N
SMILES:CCC(CC)C(=O)ON=C(COC1=CC=CC2=C1N=CC=C2)N
Found 1 products.