CymitQuimica logo

CAS 88758-69-4

:

Ethanimidamide, N-[(ethoxycarbonyl)oxy]-2-(8-quinolinyloxy)-

Description:
Ethanimidamide, N-[(ethoxycarbonyl)oxy]-2-(8-quinolinyloxy)-, identified by CAS number 88758-69-4, is a chemical compound that features a complex structure incorporating both an ethanimidamide moiety and a quinoline derivative. This compound typically exhibits characteristics such as moderate solubility in organic solvents, which is common for compounds containing aromatic systems. The presence of the ethoxycarbonyl group suggests potential reactivity, particularly in nucleophilic substitution reactions. The quinoline component may impart biological activity, as many quinoline derivatives are known for their pharmacological properties, including antimicrobial and antimalarial effects. Additionally, the compound may exhibit specific spectral properties, such as UV-Vis absorbance, due to the conjugated systems present in its structure. Overall, the unique combination of functional groups in Ethanimidamide, N-[(ethoxycarbonyl)oxy]-2-(8-quinolinyloxy)- suggests potential applications in medicinal chemistry and materials science, although specific applications would depend on further research and characterization.
Formula:C14H15N3O4
InChI:InChI=1S/C14H15N3O4/c1-2-19-14(18)21-17-12(15)9-20-11-7-3-5-10-6-4-8-16-13(10)11/h3-8H,2,9H2,1H3,(H2,15,17)
InChI key:BFZDKWCAHQHWLK-UHFFFAOYSA-N
SMILES:CCOC(=O)ON=C(COC1=CC=CC2=C1N=CC=C2)N
Found 1 products.