CAS 88758-72-9
:Ethanimidamide, N-[(3,4-dimethylbenzoyl)oxy]-2-(8-quinolinyloxy)-
Description:
Ethanimidamide, N-[(3,4-dimethylbenzoyl)oxy]-2-(8-quinolinyloxy)-, with the CAS number 88758-72-9, is a chemical compound characterized by its complex structure, which includes an ethanimidamide backbone, a benzoyl group with two methyl substituents, and a quinolinyloxy moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, which may include interactions with specific biological targets due to the presence of the quinoline and benzoyl functional groups. The presence of the ethanimidamide group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure may confer specific reactivity patterns, making it of interest in various chemical reactions or as a ligand in coordination chemistry. Additionally, the compound's stability, reactivity, and potential toxicity would need to be evaluated in the context of its intended applications. Overall, this compound represents a unique combination of functional groups that may contribute to its chemical behavior and biological activity.
Formula:C20H19N3O3
InChI:InChI=1S/C20H19N3O3/c1-13-8-9-16(11-14(13)2)20(24)26-23-18(21)12-25-17-7-3-5-15-6-4-10-22-19(15)17/h3-11H,12H2,1-2H3,(H2,21,23)
InChI key:GBAGJKZELAZTCN-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C=C1)C(=O)ON=C(COC2=CC=CC3=C2N=CC=C3)N)C
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ethanimidamide, N-[(3,4-dimethylbenzoyl)oxy]-2-(8-quinolinyloxy)-
CAS:Formula:C20H19N3O3Molecular weight:349.3832
