CAS 88758-83-2
:Ethanimidamide, N-(3-bromo-1-oxopropoxy)-2-(8-quinolinyloxy)-
Description:
Ethanimidamide, N-(3-bromo-1-oxopropoxy)-2-(8-quinolinyloxy)-, identified by CAS number 88758-83-2, is a chemical compound characterized by its complex structure that includes an ethanimidamide backbone, a bromo-substituted propoxy group, and a quinolinyloxy moiety. This compound typically exhibits properties associated with both amides and aromatic compounds, which may influence its solubility, stability, and reactivity. The presence of the bromine atom suggests potential for electrophilic substitution reactions, while the quinoline ring may impart biological activity, making it of interest in medicinal chemistry. The oxo group in the propoxy chain can also participate in hydrogen bonding, affecting the compound's interactions in various environments. Overall, the unique combination of functional groups in this compound may lead to diverse applications, particularly in pharmaceutical research, where such structures are often explored for their potential therapeutic effects. Further studies would be necessary to elucidate its specific properties and potential uses in various chemical and biological contexts.
Formula:C14H14BrN3O3
InChI:InChI=1S/C14H14BrN3O3/c15-7-6-13(19)21-18-12(16)9-20-11-5-1-3-10-4-2-8-17-14(10)11/h1-5,8H,6-7,9H2,(H2,16,18)
InChI key:LKPZZWCIVKVHRL-UHFFFAOYSA-N
SMILES:C1=CC2=C(C(=C1)OCC(=NOC(=O)CCBr)N)N=CC=C2
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ethanimidamide, N-(3-bromo-1-oxopropoxy)-2-(8-quinolinyloxy)-
CAS:Formula:C14H14BrN3O3Molecular weight:352.1833
