CymitQuimica logo

CAS 887583-52-0

:

6-(trifluoromethyl)pyridine-2-carbonitrile

Description:
6-(Trifluoromethyl)pyridine-2-carbonitrile is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a trifluoromethyl group (-CF3) at the 6-position of the pyridine ring significantly influences its chemical properties, enhancing its lipophilicity and potentially its reactivity. The carbonitrile functional group (-C≡N) at the 2-position contributes to the compound's polarity and can participate in various chemical reactions, such as nucleophilic additions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique electronic and steric properties make it a valuable building block in medicinal chemistry. Additionally, the trifluoromethyl group can impart desirable characteristics such as increased metabolic stability and improved binding affinity in biological systems. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated compounds.
Formula:C7H3F3N2
InChI:InChI=1/C7H3F3N2/c8-7(9,10)6-3-1-2-5(4-11)12-6/h1-3H
InChI key:LXNGKPOIZPTXDL-UHFFFAOYSA-N
SMILES:c1cc(C#N)nc(c1)C(F)(F)F
Synonyms:
  • 2-Cyano-6-trifluoromethylpyridine
  • 2-Pyridinecarbonitrile, 6-(Trifluoromethyl)-
  • 6-(Trifluoromethyl)pyridine-2-carbonitrile
  • 6-(TrifluoroMethyl)-2-pyridinecarbonitrile
  • 6-(trifluoromethyl)picolinonitrile
  • 2-Carbonitrile-6-trifluoromethylpyridine
Found 4 products.