CymitQuimica logo

CAS 887586-25-6

:

1-(2-Bromoethyl)-2,3,4-trifluorobenzene

Description:
1-(2-Bromoethyl)-2,3,4-trifluorobenzene is an organic compound characterized by its unique structure, which includes a bromine atom and three fluorine atoms attached to a benzene ring. The presence of the bromine atom introduces a reactive site, making it useful in various chemical reactions, including nucleophilic substitutions. The trifluoromethyl groups enhance the compound's lipophilicity and stability, influencing its reactivity and interactions with biological systems. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and materials science. Additionally, the trifluoromethyl groups can impart unique electronic properties, making it a subject of interest in the development of new materials and chemical synthesis. Safety precautions should be observed when handling this compound, as it may pose health risks due to the presence of halogens. Overall, 1-(2-Bromoethyl)-2,3,4-trifluorobenzene is a versatile compound with significant implications in various fields of chemistry.
Formula:C8H6BrF3
InChI:InChI=1S/C8H6BrF3/c9-4-3-5-1-2-6(10)8(12)7(5)11/h1-2H,3-4H2
InChI key:InChIKey=ODZDQVMPZAEHOG-UHFFFAOYSA-N
SMILES:C(CBr)C1=C(F)C(F)=C(F)C=C1
Synonyms:
  • Benzene, 1-(2-bromoethyl)-2,3,4-trifluoro-
  • 1-(2-Bromoethyl)-2,3,4-trifluorobenzene
Found 2 products.