CymitQuimica logo

CAS 887587-93-1

:

1-Pyrrolidinecarboxylicacid, 2-(5-amino-1,3,4-oxadiazol-2-yl)-, 1,1-dimethylethyl ester

Description:
1-Pyrrolidinecarboxylic acid, 2-(5-amino-1,3,4-oxadiazol-2-yl)-, 1,1-dimethylethyl ester, identified by CAS number 887587-93-1, is a chemical compound characterized by its complex structure that includes a pyrrolidine ring and an oxadiazole moiety. This compound typically exhibits properties associated with both its carboxylic acid and ester functionalities, which can influence its solubility, reactivity, and potential biological activity. The presence of the amino group in the oxadiazole structure may contribute to its potential as a bioactive molecule, possibly exhibiting pharmacological properties. Additionally, the tert-butyl ester group can enhance lipophilicity, affecting its absorption and distribution in biological systems. The compound's synthesis and characterization would involve standard organic chemistry techniques, and its applications may span medicinal chemistry, particularly in the development of new therapeutic agents. As with many such compounds, understanding its stability, reactivity, and interaction with biological targets would be crucial for its potential use in research or pharmaceutical applications.
Formula:C11H18N4O3
InChI:InChI=1S/C11H18N4O3/c1-11(2,3)18-10(16)15-6-4-5-7(15)8-13-14-9(12)17-8/h7H,4-6H2,1-3H3,(H2,12,14)
InChI key:NLUSTBYZNUQYRF-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCCC1C2=NN=C(O2)N
Synonyms:
  • 2-(5-Amino-[1,3,4]Oxadiazol-2-Yl)-Pyrrolidine-1-Carboxylic Acid Tert-Butyl Ester
Found 2 products.