CymitQuimica logo

CAS 887623-87-2

:

1,2,4-Thiadiazole, 5-chloro-3-(4-chlorophenyl)-

Description:
1,2,4-Thiadiazole, 5-chloro-3-(4-chlorophenyl)- is a heterocyclic compound characterized by a thiadiazole ring, which consists of two nitrogen atoms and one sulfur atom within a five-membered ring structure. This compound features a chlorine atom at the 5-position and a para-chlorophenyl group at the 3-position, contributing to its unique chemical properties. The presence of chlorine substituents enhances its lipophilicity and may influence its biological activity. Typically, compounds of this class exhibit a range of pharmacological activities, including antimicrobial and anti-inflammatory properties. The molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the electron-withdrawing nature of the chlorine atoms, which can affect its behavior in various chemical reactions. Overall, 1,2,4-Thiadiazole, 5-chloro-3-(4-chlorophenyl)- is a compound of interest for further research in both synthetic and applied chemistry contexts.
Formula:C8H4Cl2N2S
InChI:InChI=1S/C8H4Cl2N2S/c9-6-3-1-5(2-4-6)7-11-8(10)13-12-7/h1-4H
InChI key:MZLWEBFWFODGTC-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C2=NSC(=N2)Cl)Cl
Found 3 products.