CAS 88767-10-6
:L-Leucine,N-L-phenylalanyl-, ethyl ester, monohydrochloride (9CI)
Description:
L-Leucine, N-L-phenylalanyl-, ethyl ester, monohydrochloride (9CI) is a synthetic compound that belongs to the class of amino acid derivatives. It is characterized by the presence of the amino acids leucine and phenylalanine, which are essential for protein synthesis and play crucial roles in various metabolic processes. The compound features an ethyl ester functional group, which enhances its lipophilicity and may influence its bioavailability and solubility in biological systems. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications in biochemical research and pharmaceuticals. The molecular structure includes a chiral center, contributing to its stereoisomerism, which can affect its biological activity. This compound is often studied for its potential roles in nutrition, muscle metabolism, and as a supplement in sports science. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with exposure.
Formula:C17H26N2O3ClH
InChI:InChI=1S/C17H26N2O3.ClH/c1-4-22-17(21)15(10-12(2)3)19-16(20)14(18)11-13-8-6-5-7-9-13;/h5-9,12,14-15H,4,10-11,18H2,1-3H3,(H,19,20);1H/t14-,15-;/m0./s1
InChI key:BRJIVOCIFONKOO-YYLIZZNMSA-N
SMILES:CCOC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC1=CC=CC=C1)N.Cl
Synonyms:- Leucine,N-(3-phenyl-L-alanyl)-, ethyl ester, hydrochloride (7CI)
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
