CymitQuimica logo

CAS 88770-20-1

:

3-Thiophenecarboxylic acid, 5-iodo-, methyl ester

Description:
3-Thiophenecarboxylic acid, 5-iodo-, methyl ester is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. The presence of a carboxylic acid group and a methyl ester functional group indicates that this compound can participate in various chemical reactions, such as esterification and nucleophilic substitutions. The iodine substituent at the 5-position of the thiophene ring enhances the compound's reactivity, making it useful in synthetic organic chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical properties are influenced by the electron-withdrawing nature of the carboxylic acid and iodine groups, which can affect its acidity and reactivity. Additionally, the compound may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis due to its unique structural features. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H5IO2S
InChI:InChI=1S/C6H5IO2S/c1-9-6(8)4-2-5(7)10-3-4/h2-3H,1H3
InChI key:ACAMEEQCWLGHQW-UHFFFAOYSA-N
SMILES:COC(=O)C1=CSC(=C1)I
Found 2 products.